C21H22FN3O3 — CID 91243972
3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 91243972) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91243972 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | CN(CCC1OCCO1)c1ccc(/N=C/C2C(=O)Nc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C21H22FN3O3/c1-25(9-8-20-27-10-11-28-20)16-5-3-15(4-6-16)23-13-18-17-7-2-14(22)12-19(17)24-21(18)26/h2-7,12-13,18,20H,8-11H2,1H3,(H,24,26)/b23-13+ |
| InChIKey | NTALPNKVWGXXSN-YDZHTSKRSA-N |
| XLogP | 3.46 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|