C22H25FN4O2 — CID 91423097
6-fluoro-3-[[3-methyl-4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91423097) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 6-fluoro-3-[[3-methyl-4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-3-[[3-methyl-4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91423097 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 6-fluoro-3-[[3-methyl-4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(/N=C/C2C(=O)Nc3cc(F)ccc32)ccc1NCCN1CCOCC1 |
| InChI | InChI=1S/C22H25FN4O2/c1-15-12-17(3-5-20(15)24-6-7-27-8-10-29-11-9-27)25-14-19-18-4-2-16(23)13-21(18)26-22(19)28/h2-5,12-14,19,24H,6-11H2,1H3,(H,26,28)/b25-14+ |
| InChIKey | RUZGHVTWZNIMHM-AFUMVMLFSA-N |
| XLogP | 3.32 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|