C23H29FN4O — CID 91195491
3-[[4-[2-[di(propan-2-yl)amino]ethylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 91195491) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-[[4-[2-[di(propan-2-yl)amino]ethylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-[2-[di(propan-2-yl)amino]ethylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91195491 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[[4-[2-[di(propan-2-yl)amino]ethylamino]phenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | CC(C)N(CCNc1ccc(/N=C/C2C(=O)Nc3cc(F)ccc32)cc1)C(C)C |
| InChI | InChI=1S/C23H29FN4O/c1-15(2)28(16(3)4)12-11-25-18-6-8-19(9-7-18)26-14-21-20-10-5-17(24)13-22(20)27-23(21)29/h5-10,13-16,21,25H,11-12H2,1-4H3,(H,27,29)/b26-14+ |
| InChIKey | DTAWCMRCKNIYPZ-VULFUBBASA-N |
| XLogP | 4.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|