C22H18F2N4O — CID 135605106
6-fluoro-3-[[3-fluoro-4-(2-pyridin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol (PubChem CID 135605106) has the molecular formula C22H18F2N4O and a molecular weight of 392.41 g/mol. Its IUPAC name is 6-fluoro-3-[[3-fluoro-4-(2-pyridin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol.
| Compound Name | 6-fluoro-3-[[3-fluoro-4-(2-pyridin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135605106 |
| Molecular Formula | C22H18F2N4O |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 6-fluoro-3-[[3-fluoro-4-(2-pyridin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2cc(F)ccc2c1/C=N/c1ccc(NCCc2ccncc2)c(F)c1 |
| InChI | InChI=1S/C22H18F2N4O/c23-15-1-3-17-18(22(29)28-21(17)11-15)13-27-16-2-4-20(19(24)12-16)26-10-7-14-5-8-25-9-6-14/h1-6,8-9,11-13,26,28-29H,7,10H2/b27-13+ |
| InChIKey | QPGPVANZOWDHAJ-UVHMKAGCSA-N |
| XLogP | 4.95 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|