C22H24F2N4O2 — CID 135605098
6-fluoro-3-[[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]iminomethyl]-1H-indol-2-ol (PubChem CID 135605098) has the molecular formula C22H24F2N4O2 and a molecular weight of 414.46 g/mol. Its IUPAC name is 6-fluoro-3-[[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]iminomethyl]-1H-indol-2-ol.
| Compound Name | 6-fluoro-3-[[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]iminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135605098 |
| Molecular Formula | C22H24F2N4O2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 6-fluoro-3-[[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]iminomethyl]-1H-indol-2-ol |
| SMILES | COCCN1CCN(c2ccc(/N=C/c3c(O)[nH]c4cc(F)ccc34)cc2F)CC1 |
| InChI | InChI=1S/C22H24F2N4O2/c1-30-11-10-27-6-8-28(9-7-27)21-5-3-16(13-19(21)24)25-14-18-17-4-2-15(23)12-20(17)26-22(18)29/h2-5,12-14,26,29H,6-11H2,1H3/b25-14+ |
| InChIKey | UBJCWAMXWWLULR-AFUMVMLFSA-N |
| XLogP | 3.67 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|