C23H25F2N3O — CID 135605406
6-fluoro-3-[[3-fluoro-4-(4-propylpiperidin-1-yl)phenyl]iminomethyl]-1H-indol-2-ol (PubChem CID 135605406) has the molecular formula C23H25F2N3O and a molecular weight of 397.47 g/mol. Its IUPAC name is 6-fluoro-3-[[3-fluoro-4-(4-propylpiperidin-1-yl)phenyl]iminomethyl]-1H-indol-2-ol.
| Compound Name | 6-fluoro-3-[[3-fluoro-4-(4-propylpiperidin-1-yl)phenyl]iminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135605406 |
| Molecular Formula | C23H25F2N3O |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 6-fluoro-3-[[3-fluoro-4-(4-propylpiperidin-1-yl)phenyl]iminomethyl]-1H-indol-2-ol |
| SMILES | CCCC1CCN(c2ccc(/N=C/c3c(O)[nH]c4cc(F)ccc34)cc2F)CC1 |
| InChI | InChI=1S/C23H25F2N3O/c1-2-3-15-8-10-28(11-9-15)22-7-5-17(13-20(22)25)26-14-19-18-6-4-16(24)12-21(18)27-23(19)29/h4-7,12-15,27,29H,2-3,8-11H2,1H3/b26-14+ |
| InChIKey | USTHVWWHBSEOJP-VULFUBBASA-N |
| XLogP | 5.92 |
| TPSA | 51.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|