C21H24FN3O — CID 135605075
3-[[4-(dipropylamino)phenyl]iminomethyl]-6-fluoro-1H-indol-2-ol (PubChem CID 135605075) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is 3-[[4-(dipropylamino)phenyl]iminomethyl]-6-fluoro-1H-indol-2-ol.
| Compound Name | 3-[[4-(dipropylamino)phenyl]iminomethyl]-6-fluoro-1H-indol-2-ol |
|---|---|
| PubChem CID | 135605075 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-[[4-(dipropylamino)phenyl]iminomethyl]-6-fluoro-1H-indol-2-ol |
| SMILES | CCCN(CCC)c1ccc(/N=C/c2c(O)[nH]c3cc(F)ccc23)cc1 |
| InChI | InChI=1S/C21H24FN3O/c1-3-11-25(12-4-2)17-8-6-16(7-9-17)23-14-19-18-10-5-15(22)13-20(18)24-21(19)26/h5-10,13-14,24,26H,3-4,11-12H2,1-2H3/b23-14+ |
| InChIKey | YCNJNSQJWRIKOM-OEAKJJBVSA-N |
| XLogP | 5.39 |
| TPSA | 51.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|