C20H18N6O — CID 11898430
(4aS,8R,8aR)-6-imino-2-methyl-2'-oxospiro[1,3,4,4a,5,8a-hexahydroisoquinoline-8,3'-1H-indole]-5,7,7-tricarbonitrile (PubChem CID 11898430) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is (4aS,8R,8aR)-6-imino-2-methyl-2'-oxospiro[1,3,4,4a,5,8a-hexahydroisoquinoline-8,3'-1H-indole]-5,7,7-tricarbonitrile.
| Compound Name | (4aS,8R,8aR)-6-imino-2-methyl-2'-oxospiro[1,3,4,4a,5,8a-hexahydroisoquinoline-8,3'-1H-indole]-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11898430 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (4aS,8R,8aR)-6-imino-2-methyl-2'-oxospiro[1,3,4,4a,5,8a-hexahydroisoquinoline-8,3'-1H-indole]-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)[C@H]2CCN(C)C[C@H]2[C@]2(C(=O)Nc3ccccc32)C1(C#N)C#N |
| InChI | InChI=1S/C20H18N6O/c1-26-7-6-12-13(8-21)17(24)19(10-22,11-23)20(15(12)9-26)14-4-2-3-5-16(14)25-18(20)27/h2-5,12-13,15,24H,6-7,9H2,1H3,(H,25,27)/b24-17+/t12-,13?,15-,20-/m1/s1 |
| InChIKey | GLKUTPXXHDGFHB-UHYIZOOSSA-N |
| XLogP | 1.65 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|