C21H17N5O — CID 73130085
2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile (PubChem CID 73130085) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile.
| Compound Name | 2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 73130085 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CCCCC2C2(C(=O)N(C)c3ccccc32)C1(C#N)C#N |
| InChI | InChI=1S/C21H17N5O/c1-26-17-9-5-4-8-16(17)21(19(26)27)15-7-3-2-6-13(15)14(10-22)18(25)20(21,11-23)12-24/h4-6,8-9,14-15,25H,2-3,7H2,1H3/b25-18+ |
| InChIKey | ZVIQWRQJXJOBFJ-XIEYBQDHSA-N |
| XLogP | 2.83 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|