C25H25N5O — CID 7307426
(4R,4aR,6S)-6-tert-butyl-2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile (PubChem CID 7307426) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is (4R,4aR,6S)-6-tert-butyl-2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aR,6S)-6-tert-butyl-2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 7307426 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (4R,4aR,6S)-6-tert-butyl-2-imino-1'-methyl-2'-oxospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,3'-indole]-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[C@H](C(C)(C)C)C[C@H]2[C@]2(C(=O)N(C)c3ccccc32)C1(C#N)C#N |
| InChI | InChI=1S/C25H25N5O/c1-23(2,3)15-9-10-16-17(12-26)21(29)24(13-27,14-28)25(19(16)11-15)18-7-5-6-8-20(18)30(4)22(25)31/h5-8,10,15,17,19,29H,9,11H2,1-4H3/b29-21+/t15-,17?,19+,25+/m0/s1 |
| InChIKey | QMMYEPLXKMZBQC-OHMXRCBQSA-N |
| XLogP | 4.11 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|