C25H28N4 — CID 11895423
(4S,4aR,6R)-4-(4-tert-butylphenyl)-6-ethyl-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 11895423) has the molecular formula C25H28N4 and a molecular weight of 384.53 g/mol. Its IUPAC name is (4S,4aR,6R)-4-(4-tert-butylphenyl)-6-ethyl-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4S,4aR,6R)-4-(4-tert-butylphenyl)-6-ethyl-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 11895423 |
| Molecular Formula | C25H28N4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (4S,4aR,6R)-4-(4-tert-butylphenyl)-6-ethyl-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[C@@H](CC)C[C@@H]2[C@@H](c2ccc(C(C)(C)C)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C25H28N4/c1-5-16-6-11-19-20(12-16)22(17-7-9-18(10-8-17)24(2,3)4)25(14-27,15-28)23(29)21(19)13-26/h7-11,16,20-22,29H,5-6,12H2,1-4H3/b29-23+/t16-,20+,21?,22-/m1/s1 |
| InChIKey | BFFNKJZSSDKNJO-BVVGKQEPSA-N |
| XLogP | 5.64 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|