C24H24N2O6 — CID 166624788
1'-(4-methoxyphenyl)-2'',2'',3'-trimethyldispiro[indoline-3,2'-pyrrolidine-4',5''-[1,3]dioxane]-2,4'',6''-trione (PubChem CID 166624788) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol.
| Compound Name | 1'-(4-methoxyphenyl)-2'',2'',3'-trimethyldispiro[indoline-3,2'-pyrrolidine-4',5''-[1,3]dioxane]-2,4'',6''-trione |
|---|---|
| PubChem CID | 166624788 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | — |
| SMILES | COc1ccc(N2CC3(C(=O)OC(C)(C)OC3=O)C(C)C23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C24H24N2O6/c1-14-23(20(28)31-22(2,3)32-21(23)29)13-26(15-9-11-16(30-4)12-10-15)24(14)17-7-5-6-8-18(17)25-19(24)27/h5-12,14H,13H2,1-4H3,(H,25,27) |
| InChIKey | XLPURIQOXOINEF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|