C25H24N4O3 — CID 101216789
4-(4-methoxyphenyl)-1-methyl-2-(2-phenylacetyl)spiro[1,2,4-triazolidine-3,3'-1H-indole]-2'-one (PubChem CID 101216789) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-methyl-2-(2-phenylacetyl)spiro[1,2,4-triazolidine-3,3'-1H-indole]-2'-one.
| Compound Name | 4-(4-methoxyphenyl)-1-methyl-2-(2-phenylacetyl)spiro[1,2,4-triazolidine-3,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 101216789 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-methyl-2-(2-phenylacetyl)spiro[1,2,4-triazolidine-3,3'-1H-indole]-2'-one |
| SMILES | COc1ccc(N2CN(C)N(C(=O)Cc3ccccc3)C23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-27-17-28(19-12-14-20(32-2)15-13-19)25(21-10-6-7-11-22(21)26-24(25)31)29(27)23(30)16-18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3,(H,26,31) |
| InChIKey | PXUSQZMZQQXUCY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|