C20H22N2O3 — CID 110867159
4-[2-(4-methoxyphenyl)acetyl]-1-phenyl-1,4-diazepan-2-one (PubChem CID 110867159) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)acetyl]-1-phenyl-1,4-diazepan-2-one.
| Compound Name | 4-[2-(4-methoxyphenyl)acetyl]-1-phenyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 110867159 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)acetyl]-1-phenyl-1,4-diazepan-2-one |
| SMILES | COc1ccc(CC(=O)N2CCCN(c3ccccc3)C(=O)C2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-25-18-10-8-16(9-11-18)14-19(23)21-12-5-13-22(20(24)15-21)17-6-3-2-4-7-17/h2-4,6-11H,5,12-15H2,1H3 |
| InChIKey | MNDVVXHARCVUMI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |