C25H27N3O5 — CID 108544576
2-[1-[4-[2-(4-methoxyphenyl)acetyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 108544576) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[1-[4-[2-(4-methoxyphenyl)acetyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-[2-(4-methoxyphenyl)acetyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108544576 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[1-[4-[2-(4-methoxyphenyl)acetyl]-1,4-diazepan-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CC(=O)N2CCCN(C(=O)C(C)N3C(=O)c4ccccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H27N3O5/c1-17(28-24(31)20-6-3-4-7-21(20)25(28)32)23(30)27-13-5-12-26(14-15-27)22(29)16-18-8-10-19(33-2)11-9-18/h3-4,6-11,17H,5,12-16H2,1-2H3 |
| InChIKey | SKRBXWHPLZDNQB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|