C28H34N4O4 — CID 74229360
N-(2,6-diethylphenyl)-2-[4-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 74229360) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[4-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[4-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 74229360 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[4-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CN1CCCN(C(=O)C(C)N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C28H34N4O4/c1-4-20-10-8-11-21(5-2)25(20)29-24(33)18-30-14-9-15-31(17-16-30)26(34)19(3)32-27(35)22-12-6-7-13-23(22)28(32)36/h6-8,10-13,19H,4-5,9,14-18H2,1-3H3,(H,29,33) |
| InChIKey | UZAMJZLYYBXYOJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|