C31H38N4O2S — CID 3729037
N-(2,6-diethylphenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 3729037) has the molecular formula C31H38N4O2S and a molecular weight of 530.74 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 3729037 |
| Molecular Formula | C31H38N4O2S |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CN1CCCN(C(=S)Nc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C31H38N4O2S/c1-3-25-12-8-13-26(4-2)30(25)33-29(36)22-34-18-9-19-35(21-20-34)31(38)32-27-14-16-28(17-15-27)37-23-24-10-6-5-7-11-24/h5-8,10-17H,3-4,9,18-23H2,1-2H3,(H,32,38)(H,33,36) |
| InChIKey | GTQHARYFNFSYIQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|