C23H32N4O4S — CID 16597782
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-phenylmethoxyphenyl)acetamide (PubChem CID 16597782) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16597782 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-phenylmethoxyphenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)Nc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H32N4O4S/c1-3-26(4-2)32(29,30)27-16-14-25(15-17-27)18-23(28)24-21-10-12-22(13-11-21)31-19-20-8-6-5-7-9-20/h5-13H,3-4,14-19H2,1-2H3,(H,24,28) |
| InChIKey | WBWRGNMPSLGSLH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |