C16H25IN4O3S — CID 16597807
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-iodophenyl)acetamide (PubChem CID 16597807) has the molecular formula C16H25IN4O3S and a molecular weight of 480.37 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 16597807 |
| Molecular Formula | C16H25IN4O3S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(4-iodophenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)Nc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C16H25IN4O3S/c1-3-20(4-2)25(23,24)21-11-9-19(10-12-21)13-16(22)18-15-7-5-14(17)6-8-15/h5-8H,3-4,9-13H2,1-2H3,(H,18,22) |
| InChIKey | RTHCCUQWQOFHDH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|