About (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane
(6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane (PubChem CID 53237594) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane.
Molecular Properties
| Compound Name | (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane |
| PubChem CID | 53237594 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane |
| SMILES | COc1ccc([C@@H]2OCCNC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-20-16-9-7-15(8-10-16)18-17(13-19-11-12-21-18)14-5-3-2-4-6-14/h2-10,17-19H,11-13H2,1H3/t17-,18+/m1/s1 |
| InChIKey | ODYAKKJTFWFJCN-MSOLQXFVSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane?
The IUPAC name of (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane (CID 53237594) is (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane.
What is the SMILES notation for (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane?
The canonical SMILES for (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane is COc1ccc([C@@H]2OCCNC[C@@H]2c2ccccc2)cc1.
What is the InChIKey of (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane?
The InChIKey is ODYAKKJTFWFJCN-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H21NO2/c1-20-16-9-7-15(8-10-16)18-17(13-19-11-12-21-18)14-5-3-2-4-6-14/h2-10,17-19H,11-13H2,1H3/t17-,18+/m1/s1.
What are the key properties of (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane?
(6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane has a molecular weight of 283.37 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,7R)-7-(4-methoxyphenyl)-6-phenyl-1,4-oxazepane is sourced from PubChem (CID 53237594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).