C16H23NO — CID 100948186
(3aS,9bR)-8-methoxy-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole (PubChem CID 100948186) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (3aS,9bR)-8-methoxy-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole.
| Compound Name | (3aS,9bR)-8-methoxy-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 100948186 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (3aS,9bR)-8-methoxy-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
| SMILES | CCCN1CC[C@@H]2c3cc(OC)ccc3CC[C@@H]21 |
| InChI | InChI=1S/C16H23NO/c1-3-9-17-10-8-14-15-11-13(18-2)6-4-12(15)5-7-16(14)17/h4,6,11,14,16H,3,5,7-10H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | IZVYXSXJDMOQNY-ZBFHGGJFSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |