C16H23NO — CID 14039992
4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-8-ol (PubChem CID 14039992) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-8-ol.
| Compound Name | 4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-8-ol |
|---|---|
| PubChem CID | 14039992 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-8-ol |
| SMILES | CCCN1CCCC2c3ccc(O)cc3CCC21 |
| InChI | InChI=1S/C16H23NO/c1-2-9-17-10-3-4-15-14-7-6-13(18)11-12(14)5-8-16(15)17/h6-7,11,15-16,18H,2-5,8-10H2,1H3 |
| InChIKey | BGWNOOWFGJBORE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |