C14H19NO2 — CID 13293109
(4aR,10bR)-4-ethyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-8-ol (PubChem CID 13293109) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (4aR,10bR)-4-ethyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-8-ol.
| Compound Name | (4aR,10bR)-4-ethyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-8-ol |
|---|---|
| PubChem CID | 13293109 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4aR,10bR)-4-ethyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-8-ol |
| SMILES | CCN1CCO[C@@H]2c3ccc(O)cc3CC[C@H]21 |
| InChI | InChI=1S/C14H19NO2/c1-2-15-7-8-17-14-12-5-4-11(16)9-10(12)3-6-13(14)15/h4-5,9,13-14,16H,2-3,6-8H2,1H3/t13-,14-/m1/s1 |
| InChIKey | OADROXWBYMSSKW-ZIAGYGMSSA-N |
| XLogP | 2.10 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |