C26H32ClNO4 — CID 129243923
ethyl 3-[8-[(2-chloro-6-ethylphenyl)methoxy]-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl]propanoate (PubChem CID 129243923) has the molecular formula C26H32ClNO4 and a molecular weight of 458.00 g/mol. Its IUPAC name is ethyl 3-[8-[(2-chloro-6-ethylphenyl)methoxy]-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl]propanoate.
| Compound Name | ethyl 3-[8-[(2-chloro-6-ethylphenyl)methoxy]-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl]propanoate |
|---|---|
| PubChem CID | 129243923 |
| Molecular Formula | C26H32ClNO4 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 3-[8-[(2-chloro-6-ethylphenyl)methoxy]-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCOC2c3ccc(OCc4c(Cl)cccc4CC)cc3CCC21 |
| InChI | InChI=1S/C26H32ClNO4/c1-3-18-6-5-7-23(27)22(18)17-32-20-9-10-21-19(16-20)8-11-24-26(21)31-15-14-28(24)13-12-25(29)30-4-2/h5-7,9-10,16,24,26H,3-4,8,11-15,17H2,1-2H3 |
| InChIKey | IXLOMHBIIUQUAX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |