C18H25NO4 — CID 129243882
ethyl 3-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)propanoate (PubChem CID 129243882) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is ethyl 3-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)propanoate.
| Compound Name | ethyl 3-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 129243882 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethyl 3-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)propanoate |
| SMILES | CCOC(=O)CCN1CCOC2c3ccc(OC)cc3CCC21 |
| InChI | InChI=1S/C18H25NO4/c1-3-22-17(20)8-9-19-10-11-23-18-15-6-5-14(21-2)12-13(15)4-7-16(18)19/h5-6,12,16,18H,3-4,7-11H2,1-2H3 |
| InChIKey | CHSOMUVXRRRJTR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |