C20H22N2O4 — CID 166315798
(5-cyclopropyl-1,3-oxazol-2-yl)-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)methanone (PubChem CID 166315798) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (5-cyclopropyl-1,3-oxazol-2-yl)-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)methanone.
| Compound Name | (5-cyclopropyl-1,3-oxazol-2-yl)-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)methanone |
|---|---|
| PubChem CID | 166315798 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (5-cyclopropyl-1,3-oxazol-2-yl)-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)methanone |
| SMILES | COc1ccc2c(c1)CCC1C2OCCN1C(=O)c1ncc(C2CC2)o1 |
| InChI | InChI=1S/C20H22N2O4/c1-24-14-5-6-15-13(10-14)4-7-16-18(15)25-9-8-22(16)20(23)19-21-11-17(26-19)12-2-3-12/h5-6,10-12,16,18H,2-4,7-9H2,1H3 |
| InChIKey | JNNLBRHYSFOQSF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |