C15H21NO2 — CID 43174723
8-methoxy-3,3-dimethyl-2,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine (PubChem CID 43174723) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 8-methoxy-3,3-dimethyl-2,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine.
| Compound Name | 8-methoxy-3,3-dimethyl-2,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine |
|---|---|
| PubChem CID | 43174723 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 8-methoxy-3,3-dimethyl-2,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine |
| SMILES | COc1ccc2c(c1)CCC1NC(C)(C)COC21 |
| InChI | InChI=1S/C15H21NO2/c1-15(2)9-18-14-12-6-5-11(17-3)8-10(12)4-7-13(14)16-15/h5-6,8,13-14,16H,4,7,9H2,1-3H3 |
| InChIKey | RNTZMXAPDZFFMQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |