C15H21NO3S — CID 66228546
8-methoxy-2,2-dimethyl-1,3,4a,5,6,10b-hexahydrobenzo[f][1,4]benzothiazine 4,4-dioxide (PubChem CID 66228546) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 8-methoxy-2,2-dimethyl-1,3,4a,5,6,10b-hexahydrobenzo[f][1,4]benzothiazine 4,4-dioxide.
| Compound Name | 8-methoxy-2,2-dimethyl-1,3,4a,5,6,10b-hexahydrobenzo[f][1,4]benzothiazine 4,4-dioxide |
|---|---|
| PubChem CID | 66228546 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 8-methoxy-2,2-dimethyl-1,3,4a,5,6,10b-hexahydrobenzo[f][1,4]benzothiazine 4,4-dioxide |
| SMILES | COc1ccc2c(c1)CCC1C2NC(C)(C)CS1(=O)=O |
| InChI | InChI=1S/C15H21NO3S/c1-15(2)9-20(17,18)13-7-4-10-8-11(19-3)5-6-12(10)14(13)16-15/h5-6,8,13-14,16H,4,7,9H2,1-3H3 |
| InChIKey | KEKNOJQSXHNBTI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |