C20H25NO3 — CID 166315799
(E)-3-cyclobutyl-1-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)prop-2-en-1-one (PubChem CID 166315799) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (E)-3-cyclobutyl-1-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-cyclobutyl-1-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 166315799 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (E)-3-cyclobutyl-1-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-4-yl)prop-2-en-1-one |
| SMILES | COc1ccc2c(c1)CCC1C2OCCN1C(=O)/C=C/C1CCC1 |
| InChI | InChI=1S/C20H25NO3/c1-23-16-7-8-17-15(13-16)6-9-18-20(17)24-12-11-21(18)19(22)10-5-14-3-2-4-14/h5,7-8,10,13-14,18,20H,2-4,6,9,11-12H2,1H3/b10-5+ |
| InChIKey | QQJBHJUYKHGVLB-BJMVGYQFSA-N |
| XLogP | 3.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|