C22H26N2O4 — CID 166314142
3-ethyl-5-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-4-carbonyl)-1-methylpyridin-2-one (PubChem CID 166314142) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-ethyl-5-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-4-carbonyl)-1-methylpyridin-2-one.
| Compound Name | 3-ethyl-5-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-4-carbonyl)-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 166314142 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-ethyl-5-(8-methoxy-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-4-carbonyl)-1-methylpyridin-2-one |
| SMILES | CCc1cc(C(=O)N2CCOC3c4ccc(OC)cc4CCC32)cn(C)c1=O |
| InChI | InChI=1S/C22H26N2O4/c1-4-14-11-16(13-23(2)21(14)25)22(26)24-9-10-28-20-18-7-6-17(27-3)12-15(18)5-8-19(20)24/h6-7,11-13,19-20H,4-5,8-10H2,1-3H3 |
| InChIKey | ILHQXQIPGDQXJR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |