C17H23NO3 — CID 44591564
methyl (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylate (PubChem CID 44591564) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylate.
| Compound Name | methyl (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylate |
|---|---|
| PubChem CID | 44591564 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-9-carboxylate |
| SMILES | CCCN1CCO[C@@H]2c3cc(C(=O)OC)ccc3CC[C@H]21 |
| InChI | InChI=1S/C17H23NO3/c1-3-8-18-9-10-21-16-14-11-13(17(19)20-2)5-4-12(14)6-7-15(16)18/h4-5,11,15-16H,3,6-10H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | HXKCWCQCZGIUKL-HZPDHXFCSA-N |
| XLogP | 2.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |