C14H21N3 — CID 57007767
7-propyl-6,6a,8,9,10,10a-hexahydro-5H-pyrido[2,3-h]quinazoline (PubChem CID 57007767) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 7-propyl-6,6a,8,9,10,10a-hexahydro-5H-pyrido[2,3-h]quinazoline.
| Compound Name | 7-propyl-6,6a,8,9,10,10a-hexahydro-5H-pyrido[2,3-h]quinazoline |
|---|---|
| PubChem CID | 57007767 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 7-propyl-6,6a,8,9,10,10a-hexahydro-5H-pyrido[2,3-h]quinazoline |
| SMILES | CCCN1CCCC2c3ncncc3CCC21 |
| InChI | InChI=1S/C14H21N3/c1-2-7-17-8-3-4-12-13(17)6-5-11-9-15-10-16-14(11)12/h9-10,12-13H,2-8H2,1H3 |
| InChIKey | UJVNWWMPINWYOW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |