C15H21NS — CID 18603883
(4aR,10bS)-4-propyl-1,2,3,4a,5,10b-hexahydrothiochromeno[3,4-b]pyridine (PubChem CID 18603883) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is (4aR,10bS)-4-propyl-1,2,3,4a,5,10b-hexahydrothiochromeno[3,4-b]pyridine.
| Compound Name | (4aR,10bS)-4-propyl-1,2,3,4a,5,10b-hexahydrothiochromeno[3,4-b]pyridine |
|---|---|
| PubChem CID | 18603883 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (4aR,10bS)-4-propyl-1,2,3,4a,5,10b-hexahydrothiochromeno[3,4-b]pyridine |
| SMILES | CCCN1CCC[C@H]2c3ccccc3SC[C@@H]21 |
| InChI | InChI=1S/C15H21NS/c1-2-9-16-10-5-7-12-13-6-3-4-8-15(13)17-11-14(12)16/h3-4,6,8,12,14H,2,5,7,9-11H2,1H3/t12-,14-/m0/s1 |
| InChIKey | KTBSEVZUOASRID-JSGCOSHPSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |