C16H24ClNO — CID 18603878
(4aR,10bS)-4-butyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride (PubChem CID 18603878) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is (4aR,10bS)-4-butyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride.
| Compound Name | (4aR,10bS)-4-butyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride |
|---|---|
| PubChem CID | 18603878 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (4aR,10bS)-4-butyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride |
| SMILES | CCCCN1CCC[C@H]2c3ccccc3OC[C@@H]21.Cl |
| InChI | InChI=1S/C16H23NO.ClH/c1-2-3-10-17-11-6-8-13-14-7-4-5-9-16(14)18-12-15(13)17;/h4-5,7,9,13,15H,2-3,6,8,10-12H2,1H3;1H/t13-,15-;/m0./s1 |
| InChIKey | BHZQUTAOQNKRPW-SLHAJLBXSA-N |
| XLogP | 3.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |