C22H25NO3 — CID 14151636
[(4aS,10bR)-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-yl] benzoate (PubChem CID 14151636) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(4aS,10bR)-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-yl] benzoate.
| Compound Name | [(4aS,10bR)-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-yl] benzoate |
|---|---|
| PubChem CID | 14151636 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [(4aS,10bR)-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-yl] benzoate |
| SMILES | CCCN1CCC[C@@H]2c3cccc(OC(=O)c4ccccc4)c3OC[C@H]21 |
| InChI | InChI=1S/C22H25NO3/c1-2-13-23-14-7-11-17-18-10-6-12-20(21(18)25-15-19(17)23)26-22(24)16-8-4-3-5-9-16/h3-6,8-10,12,17,19H,2,7,11,13-15H2,1H3/t17-,19-/m1/s1 |
| InChIKey | QEQRTYVEJLNRLB-IEBWSBKVSA-N |
| XLogP | 4.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|