C22H27NO2 — CID 18603943
(4aR,10bS)-9-phenylmethoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine (PubChem CID 18603943) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (4aR,10bS)-9-phenylmethoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine.
| Compound Name | (4aR,10bS)-9-phenylmethoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine |
|---|---|
| PubChem CID | 18603943 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (4aR,10bS)-9-phenylmethoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine |
| SMILES | CCCN1CCC[C@H]2c3cc(OCc4ccccc4)ccc3OC[C@@H]21 |
| InChI | InChI=1S/C22H27NO2/c1-2-12-23-13-6-9-19-20-14-18(10-11-22(20)25-16-21(19)23)24-15-17-7-4-3-5-8-17/h3-5,7-8,10-11,14,19,21H,2,6,9,12-13,15-16H2,1H3/t19-,21-/m0/s1 |
| InChIKey | ADFTWMSFYOFXTG-FPOVZHCZSA-N |
| XLogP | 4.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |