C11H15N3 — CID 125451162
(6aS,10aS)-5,6,6a,7,8,9,10,10a-octahydropyrimido[5,4-c]quinoline (PubChem CID 125451162) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is (6aS,10aS)-5,6,6a,7,8,9,10,10a-octahydropyrimido[5,4-c]quinoline.
| Compound Name | (6aS,10aS)-5,6,6a,7,8,9,10,10a-octahydropyrimido[5,4-c]quinoline |
|---|---|
| PubChem CID | 125451162 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (6aS,10aS)-5,6,6a,7,8,9,10,10a-octahydropyrimido[5,4-c]quinoline |
| SMILES | c1ncc2c(n1)[C@H]1CCCC[C@@H]1NC2 |
| InChI | InChI=1S/C11H15N3/c1-2-4-10-9(3-1)11-8(6-13-10)5-12-7-14-11/h5,7,9-10,13H,1-4,6H2/t9-,10-/m0/s1 |
| InChIKey | ACVQLXWCQJRMCE-UWVGGRQHSA-N |
| XLogP | 1.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |