About 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine
2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine (PubChem CID 175727535) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine.
Analyze 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine?
The IUPAC name of 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine (CID 175727535) is 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine is CC1NCc2cncnc2O1.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine?
The InChIKey is RTIIWHJJENVFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c1-5-9-3-6-2-8-4-10-7(6)11-5/h2,4-5,9H,3H2,1H3.
What are the key properties of 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine?
2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine has a molecular weight of 151.17 g/mol, XLogP of 0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-pyrimido[5,4-e][1,3]oxazine is sourced from PubChem (CID 175727535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).