C6H7N3O — CID 45080114
3,4-dihydro-1H-pyrimido[4,5-c]oxazine (PubChem CID 45080114) has the molecular formula C6H7N3O and a molecular weight of 137.14 g/mol. Its IUPAC name is 3,4-dihydro-1H-pyrimido[4,5-c]oxazine.
| Compound Name | 3,4-dihydro-1H-pyrimido[4,5-c]oxazine |
|---|---|
| PubChem CID | 45080114 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 3,4-dihydro-1H-pyrimido[4,5-c]oxazine |
| SMILES | c1ncc2c(n1)NOCC2 |
| InChI | InChI=1S/C6H7N3O/c1-2-10-9-6-5(1)3-7-4-8-6/h3-4H,1-2H2,(H,7,8,9) |
| InChIKey | OATGMUUQJINGAP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |