C9H11N3 — CID 154397752
5,8,9,10-tetrahydropyrimido[4,5-d]azocine (PubChem CID 154397752) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 5,8,9,10-tetrahydropyrimido[4,5-d]azocine.
| Compound Name | 5,8,9,10-tetrahydropyrimido[4,5-d]azocine |
|---|---|
| PubChem CID | 154397752 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5,8,9,10-tetrahydropyrimido[4,5-d]azocine |
| SMILES | C1=CNCCc2ncncc2C1 |
| InChI | InChI=1S/C9H11N3/c1-2-8-6-11-7-12-9(8)3-5-10-4-1/h1,4,6-7,10H,2-3,5H2 |
| InChIKey | UJJAOHHANXGVFQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |