C11H10N4 — CID 15155862
3,5,10,12-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene (PubChem CID 15155862) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 3,5,10,12-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene.
| Compound Name | 3,5,10,12-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene |
|---|---|
| PubChem CID | 15155862 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3,5,10,12-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene |
| SMILES | c1cnc2c(c1)-c1ncncc1CCN2 |
| InChI | InChI=1S/C11H10N4/c1-2-9-10-8(6-12-7-15-10)3-5-14-11(9)13-4-1/h1-2,4,6-7H,3,5H2,(H,13,14) |
| InChIKey | SAFVICRKLDPVIP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |