C10H10N8 — CID 71429070
8-(8,9-dihydro-7H-purin-8-yl)-8,9-dihydro-7H-purine (PubChem CID 71429070) has the molecular formula C10H10N8 and a molecular weight of 242.25 g/mol. Its IUPAC name is 8-(8,9-dihydro-7H-purin-8-yl)-8,9-dihydro-7H-purine.
| Compound Name | 8-(8,9-dihydro-7H-purin-8-yl)-8,9-dihydro-7H-purine |
|---|---|
| PubChem CID | 71429070 |
| Molecular Formula | C10H10N8 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 8-(8,9-dihydro-7H-purin-8-yl)-8,9-dihydro-7H-purine |
| SMILES | c1ncc2c(n1)NC(C1Nc3cncnc3N1)N2 |
| InChI | InChI=1S/C10H10N8/c1-5-7(13-3-11-1)17-9(15-5)10-16-6-2-12-4-14-8(6)18-10/h1-4,9-10,15-16H,(H,11,13,17)(H,12,14,18) |
| InChIKey | BCXMDBOPSWLDIG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |