C9H10N4O — CID 175812763
5-cyclopropyl-7,8-dihydropteridin-6-one (PubChem CID 175812763) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 5-cyclopropyl-7,8-dihydropteridin-6-one.
| Compound Name | 5-cyclopropyl-7,8-dihydropteridin-6-one |
|---|---|
| PubChem CID | 175812763 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-cyclopropyl-7,8-dihydropteridin-6-one |
| SMILES | O=C1CNc2ncncc2N1C1CC1 |
| InChI | InChI=1S/C9H10N4O/c14-8-4-11-9-7(3-10-5-12-9)13(8)6-1-2-6/h3,5-6H,1-2,4H2,(H,10,11,12) |
| InChIKey | PRZHZISXIINFMQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |