C13H15FN2O — CID 105494352
1-cyclopentyl-6-fluoro-3,4-dihydroquinoxalin-2-one (PubChem CID 105494352) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 1-cyclopentyl-6-fluoro-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-cyclopentyl-6-fluoro-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 105494352 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-cyclopentyl-6-fluoro-3,4-dihydroquinoxalin-2-one |
| SMILES | O=C1CNc2cc(F)ccc2N1C1CCCC1 |
| InChI | InChI=1S/C13H15FN2O/c14-9-5-6-12-11(7-9)15-8-13(17)16(12)10-3-1-2-4-10/h5-7,10,15H,1-4,8H2 |
| InChIKey | ZKCGTZPODAHKRF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |