C13H16ClFN2O — CID 71432476
3-amino-1-cyclopentyl-5-fluoro-3H-indol-2-one;hydrochloride (PubChem CID 71432476) has the molecular formula C13H16ClFN2O and a molecular weight of 270.73 g/mol. Its IUPAC name is 3-amino-1-cyclopentyl-5-fluoro-3H-indol-2-one;hydrochloride.
| Compound Name | 3-amino-1-cyclopentyl-5-fluoro-3H-indol-2-one;hydrochloride |
|---|---|
| PubChem CID | 71432476 |
| Molecular Formula | C13H16ClFN2O |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-amino-1-cyclopentyl-5-fluoro-3H-indol-2-one;hydrochloride |
| SMILES | Cl.NC1C(=O)N(C2CCCC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H15FN2O.ClH/c14-8-5-6-11-10(7-8)12(15)13(17)16(11)9-3-1-2-4-9;/h5-7,9,12H,1-4,15H2;1H |
| InChIKey | YZLVGEOROOZRHL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |