C23H32FN3O2 — CID 134578397
N-[1-(1-cyclohexylpiperidin-4-yl)-5-fluoro-2-oxo-3H-indol-3-yl]-2-methylpropanamide (PubChem CID 134578397) has the molecular formula C23H32FN3O2 and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[1-(1-cyclohexylpiperidin-4-yl)-5-fluoro-2-oxo-3H-indol-3-yl]-2-methylpropanamide.
| Compound Name | N-[1-(1-cyclohexylpiperidin-4-yl)-5-fluoro-2-oxo-3H-indol-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 134578397 |
| Molecular Formula | C23H32FN3O2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-[1-(1-cyclohexylpiperidin-4-yl)-5-fluoro-2-oxo-3H-indol-3-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1C(=O)N(C2CCN(C3CCCCC3)CC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C23H32FN3O2/c1-15(2)22(28)25-21-19-14-16(24)8-9-20(19)27(23(21)29)18-10-12-26(13-11-18)17-6-4-3-5-7-17/h8-9,14-15,17-18,21H,3-7,10-13H2,1-2H3,(H,25,28) |
| InChIKey | MPPSPNNFPGSWQY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |