C9H11N5O2 — CID 152618004
5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-7-carboxamide (PubChem CID 152618004) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-7-carboxamide.
| Compound Name | 5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-7-carboxamide |
|---|---|
| PubChem CID | 152618004 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-7-carboxamide |
| SMILES | CN1C(=O)C(C(N)=O)CNc2ncncc21 |
| InChI | InChI=1S/C9H11N5O2/c1-14-6-3-11-4-13-8(6)12-2-5(7(10)15)9(14)16/h3-5H,2H2,1H3,(H2,10,15)(H,11,12,13) |
| InChIKey | ZAXRBOAKLFEGLW-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|