About 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide
3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide (PubChem CID 135312174) has the molecular formula C18H15N5O
and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide.
Molecular Properties
| Compound Name | 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide |
| PubChem CID | 135312174 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide |
| SMILES | NC(=O)c1cccc(N2CNc3ncncc32)c1-c1ccccc1 |
| InChI | InChI=1S/C18H15N5O/c19-17(24)13-7-4-8-14(16(13)12-5-2-1-3-6-12)23-11-22-18-15(23)9-20-10-21-18/h1-10H,11H2,(H2,19,24)(H,20,21,22) |
| InChIKey | GXFONAZPNDRZQL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide?
The IUPAC name of 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide (CID 135312174) is 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide.
What is the SMILES notation for 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide?
The canonical SMILES for 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide is NC(=O)c1cccc(N2CNc3ncncc32)c1-c1ccccc1.
What is the InChIKey of 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide?
The InChIKey is GXFONAZPNDRZQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O/c19-17(24)13-7-4-8-14(16(13)12-5-2-1-3-6-12)23-11-22-18-15(23)9-20-10-21-18/h1-10H,11H2,(H2,19,24)(H,20,21,22).
What are the key properties of 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide?
3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide has a molecular weight of 317.35 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8,9-dihydropurin-7-yl)-2-phenylbenzamide is sourced from PubChem (CID 135312174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).