C11H14N4O2 — CID 10331588
5,7,7,9-tetramethylpyrimido[4,5-b][1,4]diazepine-6,8-dione (PubChem CID 10331588) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 5,7,7,9-tetramethylpyrimido[4,5-b][1,4]diazepine-6,8-dione.
| Compound Name | 5,7,7,9-tetramethylpyrimido[4,5-b][1,4]diazepine-6,8-dione |
|---|---|
| PubChem CID | 10331588 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 5,7,7,9-tetramethylpyrimido[4,5-b][1,4]diazepine-6,8-dione |
| SMILES | CN1C(=O)C(C)(C)C(=O)N(C)c2ncncc21 |
| InChI | InChI=1S/C11H14N4O2/c1-11(2)9(16)14(3)7-5-12-6-13-8(7)15(4)10(11)17/h5-6H,1-4H3 |
| InChIKey | VYVJSXDENHLCGX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|