C13H16N2O3 — CID 173096703
1-(2-hydroxyethyl)-6-methyl-2-oxo-3,4-dihydroquinoline-3-carboxamide (PubChem CID 173096703) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-6-methyl-2-oxo-3,4-dihydroquinoline-3-carboxamide.
| Compound Name | 1-(2-hydroxyethyl)-6-methyl-2-oxo-3,4-dihydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 173096703 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-6-methyl-2-oxo-3,4-dihydroquinoline-3-carboxamide |
| SMILES | Cc1ccc2c(c1)CC(C(N)=O)C(=O)N2CCO |
| InChI | InChI=1S/C13H16N2O3/c1-8-2-3-11-9(6-8)7-10(12(14)17)13(18)15(11)4-5-16/h2-3,6,10,16H,4-5,7H2,1H3,(H2,14,17) |
| InChIKey | CHCVHCIDCIRWRF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|